C19H19NO5S — CID 18123272
(2-morpholin-4-yl-2-oxo-1-phenylethyl) 5-acetylthiophene-2-carboxylate (PubChem CID 18123272) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxo-1-phenylethyl) 5-acetylthiophene-2-carboxylate.
| Compound Name | (2-morpholin-4-yl-2-oxo-1-phenylethyl) 5-acetylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 18123272 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | (2-morpholin-4-yl-2-oxo-1-phenylethyl) 5-acetylthiophene-2-carboxylate |
| SMILES | CC(=O)c1ccc(C(=O)OC(C(=O)N2CCOCC2)c2ccccc2)s1 |
| InChI | InChI=1S/C19H19NO5S/c1-13(21)15-7-8-16(26-15)19(23)25-17(14-5-3-2-4-6-14)18(22)20-9-11-24-12-10-20/h2-8,17H,9-12H2,1H3 |
| InChIKey | BGMDBCZUCBAWGZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |