C22H22N2O4 — CID 24519167
(2-morpholin-4-yl-2-oxo-1-phenylethyl) 2-methyl-1H-indole-3-carboxylate (PubChem CID 24519167) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxo-1-phenylethyl) 2-methyl-1H-indole-3-carboxylate.
| Compound Name | (2-morpholin-4-yl-2-oxo-1-phenylethyl) 2-methyl-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 24519167 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (2-morpholin-4-yl-2-oxo-1-phenylethyl) 2-methyl-1H-indole-3-carboxylate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)OC(C(=O)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O4/c1-15-19(17-9-5-6-10-18(17)23-15)22(26)28-20(16-7-3-2-4-8-16)21(25)24-11-13-27-14-12-24/h2-10,20,23H,11-14H2,1H3 |
| InChIKey | FKHXFPWJUSJKNS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |