C18H18ClN3O6S — CID 42936172
(2-morpholin-4-yl-2-oxo-1-phenylethyl) 5-chloro-2-methylsulfonylpyrimidine-4-carboxylate (PubChem CID 42936172) has the molecular formula C18H18ClN3O6S and a molecular weight of 439.88 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxo-1-phenylethyl) 5-chloro-2-methylsulfonylpyrimidine-4-carboxylate.
| Compound Name | (2-morpholin-4-yl-2-oxo-1-phenylethyl) 5-chloro-2-methylsulfonylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 42936172 |
| Molecular Formula | C18H18ClN3O6S |
| Molecular Weight | 439.88 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | (2-morpholin-4-yl-2-oxo-1-phenylethyl) 5-chloro-2-methylsulfonylpyrimidine-4-carboxylate |
| SMILES | CS(=O)(=O)c1ncc(Cl)c(C(=O)OC(C(=O)N2CCOCC2)c2ccccc2)n1 |
| InChI | InChI=1S/C18H18ClN3O6S/c1-29(25,26)18-20-11-13(19)14(21-18)17(24)28-15(12-5-3-2-4-6-12)16(23)22-7-9-27-10-8-22/h2-6,11,15H,7-10H2,1H3 |
| InChIKey | UWRQOIVBGOJEGZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 115.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.88 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |