C23H27ClN2O6S — CID 43031545
(2-morpholin-4-yl-2-oxo-1-phenylethyl) 4-chloro-3-(diethylsulfamoyl)benzoate (PubChem CID 43031545) has the molecular formula C23H27ClN2O6S and a molecular weight of 495.00 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxo-1-phenylethyl) 4-chloro-3-(diethylsulfamoyl)benzoate.
| Compound Name | (2-morpholin-4-yl-2-oxo-1-phenylethyl) 4-chloro-3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 43031545 |
| Molecular Formula | C23H27ClN2O6S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | (2-morpholin-4-yl-2-oxo-1-phenylethyl) 4-chloro-3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OC(C(=O)N2CCOCC2)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C23H27ClN2O6S/c1-3-26(4-2)33(29,30)20-16-18(10-11-19(20)24)23(28)32-21(17-8-6-5-7-9-17)22(27)25-12-14-31-15-13-25/h5-11,16,21H,3-4,12-15H2,1-2H3 |
| InChIKey | ISAGOUSBVKPCHA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |