C25H25NO6 — CID 18269190
(2-oxo-1-phenyl-2-piperidin-1-ylethyl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate (PubChem CID 18269190) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is (2-oxo-1-phenyl-2-piperidin-1-ylethyl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate.
| Compound Name | (2-oxo-1-phenyl-2-piperidin-1-ylethyl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 18269190 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | (2-oxo-1-phenyl-2-piperidin-1-ylethyl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)OC(C(=O)N3CCCCC3)c3ccccc3)ccc12 |
| InChI | InChI=1S/C25H25NO6/c1-17-14-22(27)31-21-15-19(10-11-20(17)21)30-16-23(28)32-24(18-8-4-2-5-9-18)25(29)26-12-6-3-7-13-26/h2,4-5,8-11,14-15,24H,3,6-7,12-13,16H2,1H3 |
| InChIKey | MLXOSVLOQSFIQA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|