C19H25NO5 — CID 4540325
[2-(cyclopentylamino)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate (PubChem CID 4540325) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 4540325 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate |
| SMILES | O=C(COC(=O)c1ccc(OCC2CCCO2)cc1)NC1CCCC1 |
| InChI | InChI=1S/C19H25NO5/c21-18(20-15-4-1-2-5-15)13-25-19(22)14-7-9-16(10-8-14)24-12-17-6-3-11-23-17/h7-10,15,17H,1-6,11-13H2,(H,20,21) |
| InChIKey | CVIGKEXUSRGYPA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |