C24H31NO5 — CID 7445470
[2-(1-adamantylamino)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate (PubChem CID 7445470) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 7445470 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate |
| SMILES | O=C(COC(=O)c1ccc(OC[C@H]2CCCO2)cc1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H31NO5/c26-22(25-24-11-16-8-17(12-24)10-18(9-16)13-24)15-30-23(27)19-3-5-20(6-4-19)29-14-21-2-1-7-28-21/h3-6,16-18,21H,1-2,7-15H2,(H,25,26)/t16?,17?,18?,21-,24?/m1/s1 |
| InChIKey | IZISWECFGJNAOG-WWKNUYBVSA-N |
| XLogP | 3.49 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |