C20H23NO5S — CID 8951362
[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-[[(2S)-oxolan-2-yl]methoxy]benzoate (PubChem CID 8951362) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-[[(2S)-oxolan-2-yl]methoxy]benzoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-[[(2S)-oxolan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 8951362 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-[[(2S)-oxolan-2-yl]methoxy]benzoate |
| SMILES | O=C(COC(=O)c1ccc(OC[C@@H]2CCCO2)cc1)NCCc1cccs1 |
| InChI | InChI=1S/C20H23NO5S/c22-19(21-10-9-18-4-2-12-27-18)14-26-20(23)15-5-7-16(8-6-15)25-13-17-3-1-11-24-17/h2,4-8,12,17H,1,3,9-11,13-14H2,(H,21,22)/t17-/m0/s1 |
| InChIKey | IUTIZVHCXOTGDQ-KRWDZBQOSA-N |
| XLogP | 2.82 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |