C24H29NO6 — CID 8653004
[2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 4-[[(2S)-oxolan-2-yl]methoxy]benzoate (PubChem CID 8653004) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is [2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 4-[[(2S)-oxolan-2-yl]methoxy]benzoate.
| Compound Name | [2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 4-[[(2S)-oxolan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 8653004 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | [2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 4-[[(2S)-oxolan-2-yl]methoxy]benzoate |
| SMILES | Cc1ccc(OCCNC(=O)COC(=O)c2ccc(OC[C@@H]3CCCO3)cc2)c(C)c1 |
| InChI | InChI=1S/C24H29NO6/c1-17-5-10-22(18(2)14-17)29-13-11-25-23(26)16-31-24(27)19-6-8-20(9-7-19)30-15-21-4-3-12-28-21/h5-10,14,21H,3-4,11-13,15-16H2,1-2H3,(H,25,26)/t21-/m0/s1 |
| InChIKey | CYLXGWUBSUJFOO-NRFANRHFSA-N |
| XLogP | 3.21 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|