C19H21ClN2O4 — CID 9079295
[2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 3-amino-4-chlorobenzoate (PubChem CID 9079295) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is [2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 9079295 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
| SMILES | Cc1ccc(OCCNC(=O)COC(=O)c2ccc(Cl)c(N)c2)c(C)c1 |
| InChI | InChI=1S/C19H21ClN2O4/c1-12-3-6-17(13(2)9-12)25-8-7-22-18(23)11-26-19(24)14-4-5-15(20)16(21)10-14/h3-6,9-10H,7-8,11,21H2,1-2H3,(H,22,23) |
| InChIKey | MPFPMWGMJCNTMK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|