C18H21NO4S — CID 9009190
[2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 5-methylthiophene-2-carboxylate (PubChem CID 9009190) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is [2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 5-methylthiophene-2-carboxylate.
| Compound Name | [2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 5-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 9009190 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | [2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 5-methylthiophene-2-carboxylate |
| SMILES | Cc1ccc(OCCNC(=O)COC(=O)c2ccc(C)s2)c(C)c1 |
| InChI | InChI=1S/C18H21NO4S/c1-12-4-6-15(13(2)10-12)22-9-8-19-17(20)11-23-18(21)16-7-5-14(3)24-16/h4-7,10H,8-9,11H2,1-3H3,(H,19,20) |
| InChIKey | VDHOKANYZPYRFP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|