C19H19Cl2NO4 — CID 9203133
[2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 2,6-dichlorobenzoate (PubChem CID 9203133) has the molecular formula C19H19Cl2NO4 and a molecular weight of 396.27 g/mol. Its IUPAC name is [2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 2,6-dichlorobenzoate.
| Compound Name | [2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 9203133 |
| Molecular Formula | C19H19Cl2NO4 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | [2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] 2,6-dichlorobenzoate |
| SMILES | Cc1ccc(OCCNC(=O)COC(=O)c2c(Cl)cccc2Cl)c(C)c1 |
| InChI | InChI=1S/C19H19Cl2NO4/c1-12-6-7-16(13(2)10-12)25-9-8-22-17(23)11-26-19(24)18-14(20)4-3-5-15(18)21/h3-7,10H,8-9,11H2,1-2H3,(H,22,23) |
| InChIKey | HKAKLZUYJXWHHG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|