C13H17ClN2O4 — CID 63662025
[2-(3-methoxypropylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate (PubChem CID 63662025) has the molecular formula C13H17ClN2O4 and a molecular weight of 300.74 g/mol. Its IUPAC name is [2-(3-methoxypropylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate.
| Compound Name | [2-(3-methoxypropylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate |
|---|---|
| PubChem CID | 63662025 |
| Molecular Formula | C13H17ClN2O4 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | [2-(3-methoxypropylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate |
| SMILES | COCCCNC(=O)COC(=O)c1c(N)cccc1Cl |
| InChI | InChI=1S/C13H17ClN2O4/c1-19-7-3-6-16-11(17)8-20-13(18)12-9(14)4-2-5-10(12)15/h2,4-5H,3,6-8,15H2,1H3,(H,16,17) |
| InChIKey | XJBCKIOBFHWFGR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|