C13H18N2O4 — CID 60625420
[2-(3-methoxypropylamino)-2-oxoethyl] 4-aminobenzoate (PubChem CID 60625420) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is [2-(3-methoxypropylamino)-2-oxoethyl] 4-aminobenzoate.
| Compound Name | [2-(3-methoxypropylamino)-2-oxoethyl] 4-aminobenzoate |
|---|---|
| PubChem CID | 60625420 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | [2-(3-methoxypropylamino)-2-oxoethyl] 4-aminobenzoate |
| SMILES | COCCCNC(=O)COC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H18N2O4/c1-18-8-2-7-15-12(16)9-19-13(17)10-3-5-11(14)6-4-10/h3-6H,2,7-9,14H2,1H3,(H,15,16) |
| InChIKey | CRZGIFNZNQNYSJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|