C17H24N2O5 — CID 9016157
[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 4-acetamidobenzoate (PubChem CID 9016157) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is [2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 4-acetamidobenzoate.
| Compound Name | [2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 9016157 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OCC(=O)NCCCOC(C)C)cc1 |
| InChI | InChI=1S/C17H24N2O5/c1-12(2)23-10-4-9-18-16(21)11-24-17(22)14-5-7-15(8-6-14)19-13(3)20/h5-8,12H,4,9-11H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | FTOMGDCPAIDFNE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|