C16H20N2O4 — CID 9201990
[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 4-cyanobenzoate (PubChem CID 9201990) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is [2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 4-cyanobenzoate.
| Compound Name | [2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 9201990 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 4-cyanobenzoate |
| SMILES | CC(C)OCCCNC(=O)COC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H20N2O4/c1-12(2)21-9-3-8-18-15(19)11-22-16(20)14-6-4-13(10-17)5-7-14/h4-7,12H,3,8-9,11H2,1-2H3,(H,18,19) |
| InChIKey | ZBSVQHMGQKIYDA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|