C13H13F3N2O4 — CID 7949725
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-acetamidobenzoate (PubChem CID 7949725) has the molecular formula C13H13F3N2O4 and a molecular weight of 318.25 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-acetamidobenzoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 7949725 |
| Molecular Formula | C13H13F3N2O4 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OCC(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13F3N2O4/c1-8(19)18-10-4-2-9(3-5-10)12(21)22-6-11(20)17-7-13(14,15)16/h2-5H,6-7H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | RLOJKLJJNCWGHJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |