C11H10F3NO4 — CID 2624735
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-hydroxybenzoate (PubChem CID 2624735) has the molecular formula C11H10F3NO4 and a molecular weight of 277.20 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-hydroxybenzoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 2624735 |
| Molecular Formula | C11H10F3NO4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(O)cc1)NCC(F)(F)F |
| InChI | InChI=1S/C11H10F3NO4/c12-11(13,14)6-15-9(17)5-19-10(18)7-1-3-8(16)4-2-7/h1-4,16H,5-6H2,(H,15,17) |
| InChIKey | BXFIEQDADNCQRZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |