C12H10F3IN2O4 — CID 26734941
[2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 4-iodobenzoate (PubChem CID 26734941) has the molecular formula C12H10F3IN2O4 and a molecular weight of 430.12 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 4-iodobenzoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 4-iodobenzoate |
|---|---|
| PubChem CID | 26734941 |
| Molecular Formula | C12H10F3IN2O4 |
| Molecular Weight | 430.12 g/mol |
| Exact Mass | 429.96 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 4-iodobenzoate |
| SMILES | O=C(COC(=O)c1ccc(I)cc1)NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H10F3IN2O4/c13-12(14,15)6-17-11(21)18-9(19)5-22-10(20)7-1-3-8(16)4-2-7/h1-4H,5-6H2,(H2,17,18,19,21) |
| InChIKey | WNDIUNDYBIBWLO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.12 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|