C13H12F3N3O6 — CID 8887025
[2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 4-methyl-3-nitrobenzoate (PubChem CID 8887025) has the molecular formula C13H12F3N3O6 and a molecular weight of 363.25 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 4-methyl-3-nitrobenzoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 4-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 8887025 |
| Molecular Formula | C13H12F3N3O6 |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 4-methyl-3-nitrobenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NC(=O)NCC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12F3N3O6/c1-7-2-3-8(4-9(7)19(23)24)11(21)25-5-10(20)18-12(22)17-6-13(14,15)16/h2-4H,5-6H2,1H3,(H2,17,18,20,22) |
| InChIKey | GSXIVUUSAZBWIO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|