C12H10F3N3O6 — CID 26726755
[2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 2-nitrobenzoate (PubChem CID 26726755) has the molecular formula C12H10F3N3O6 and a molecular weight of 349.22 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 2-nitrobenzoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 26726755 |
| Molecular Formula | C12H10F3N3O6 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 2-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1[N+](=O)[O-])NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H10F3N3O6/c13-12(14,15)6-16-11(21)17-9(19)5-24-10(20)7-3-1-2-4-8(7)18(22)23/h1-4H,5-6H2,(H2,16,17,19,21) |
| InChIKey | YQRLUUCVFDKWAY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|