C19H13F3N2O5 — CID 2447871
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 2447871) has the molecular formula C19H13F3N2O5 and a molecular weight of 406.32 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 2447871 |
| Molecular Formula | C19H13F3N2O5 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1)NCC(F)(F)F |
| InChI | InChI=1S/C19H13F3N2O5/c20-19(21,22)10-23-15(25)9-29-18(28)11-5-7-12(8-6-11)24-16(26)13-3-1-2-4-14(13)17(24)27/h1-8H,9-10H2,(H,23,25) |
| InChIKey | BNYXDJFDNWFTIL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|