C21H19N3O7 — CID 16500624
[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 16500624) has the molecular formula C21H19N3O7 and a molecular weight of 425.40 g/mol. Its IUPAC name is [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 16500624 |
| Molecular Formula | C21H19N3O7 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | COCCNC(=O)NC(=O)COC(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H19N3O7/c1-30-11-10-22-21(29)23-17(25)12-31-20(28)13-6-8-14(9-7-13)24-18(26)15-4-2-3-5-16(15)19(24)27/h2-9H,10-12H2,1H3,(H2,22,23,25,29) |
| InChIKey | NJCQGDGALUGDJE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|