C19H14ClN3O6 — CID 2616922
[2-(methylcarbamoylamino)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2616922) has the molecular formula C19H14ClN3O6 and a molecular weight of 415.79 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2616922 |
| Molecular Formula | C19H14ClN3O6 |
| Molecular Weight | 415.79 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CNC(=O)NC(=O)COC(=O)c1ccc2c(c1)C(=O)N(c1ccc(Cl)cc1)C2=O |
| InChI | InChI=1S/C19H14ClN3O6/c1-21-19(28)22-15(24)9-29-18(27)10-2-7-13-14(8-10)17(26)23(16(13)25)12-5-3-11(20)4-6-12/h2-8H,9H2,1H3,(H2,21,22,24,28) |
| InChIKey | UYNRGTVHYWCENG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.79 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|