C24H16ClFN2O6 — CID 42980279
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 42980279) has the molecular formula C24H16ClFN2O6 and a molecular weight of 482.85 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 42980279 |
| Molecular Formula | C24H16ClFN2O6 |
| Molecular Weight | 482.85 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccc(Cl)cc1NC(=O)COC(=O)c1ccc2c(c1)C(=O)N(c1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C24H16ClFN2O6/c1-33-20-9-3-14(25)11-19(20)27-21(29)12-34-24(32)13-2-8-17-18(10-13)23(31)28(22(17)30)16-6-4-15(26)5-7-16/h2-11H,12H2,1H3,(H,27,29) |
| InChIKey | QNJCBEFXNKLFBA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.85 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|