C23H13F3N2O5 — CID 16500646
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 16500646) has the molecular formula C23H13F3N2O5 and a molecular weight of 454.36 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 16500646 |
| Molecular Formula | C23H13F3N2O5 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C23H13F3N2O5/c24-16-9-10-17(20(26)19(16)25)27-18(29)11-33-23(32)12-5-7-13(8-6-12)28-21(30)14-3-1-2-4-15(14)22(28)31/h1-10H,11H2,(H,27,29) |
| InChIKey | RZYQRWSFOFBASL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|