C23H14Cl2N2O5 — CID 42964807
[2-(2,5-dichloroanilino)-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 42964807) has the molecular formula C23H14Cl2N2O5 and a molecular weight of 469.28 g/mol. Its IUPAC name is [2-(2,5-dichloroanilino)-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 42964807 |
| Molecular Formula | C23H14Cl2N2O5 |
| Molecular Weight | 469.28 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(N2C(=O)c3ccccc3C2=O)c1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C23H14Cl2N2O5/c24-14-8-9-18(25)19(11-14)26-20(28)12-32-23(31)13-4-3-5-15(10-13)27-21(29)16-6-1-2-7-17(16)22(27)30/h1-11H,12H2,(H,26,28) |
| InChIKey | DYPDAHSZTCMDBF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.28 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|