C13H9Cl2NO4 — CID 26984403
[2-(2,5-dichloroanilino)-2-oxoethyl] furan-3-carboxylate (PubChem CID 26984403) has the molecular formula C13H9Cl2NO4 and a molecular weight of 314.12 g/mol. Its IUPAC name is [2-(2,5-dichloroanilino)-2-oxoethyl] furan-3-carboxylate.
| Compound Name | [2-(2,5-dichloroanilino)-2-oxoethyl] furan-3-carboxylate |
|---|---|
| PubChem CID | 26984403 |
| Molecular Formula | C13H9Cl2NO4 |
| Molecular Weight | 314.12 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | [2-(2,5-dichloroanilino)-2-oxoethyl] furan-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccoc1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H9Cl2NO4/c14-9-1-2-10(15)11(5-9)16-12(17)7-20-13(18)8-3-4-19-6-8/h1-6H,7H2,(H,16,17) |
| InChIKey | VUFVPFCVTOPUBI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.12 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |