C30H17Cl2NO7 — CID 19646054
[4-[2-[3-(1,3-dioxoisoindol-2-yl)benzoyl]oxyacetyl]phenyl] 3,4-dichlorobenzoate (PubChem CID 19646054) has the molecular formula C30H17Cl2NO7 and a molecular weight of 574.37 g/mol. Its IUPAC name is [4-[2-[3-(1,3-dioxoisoindol-2-yl)benzoyl]oxyacetyl]phenyl] 3,4-dichlorobenzoate.
| Compound Name | [4-[2-[3-(1,3-dioxoisoindol-2-yl)benzoyl]oxyacetyl]phenyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 19646054 |
| Molecular Formula | C30H17Cl2NO7 |
| Molecular Weight | 574.37 g/mol |
| Exact Mass | 573.04 |
| IUPAC Name | [4-[2-[3-(1,3-dioxoisoindol-2-yl)benzoyl]oxyacetyl]phenyl] 3,4-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1cccc(N2C(=O)c3ccccc3C2=O)c1)c1ccc(OC(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C30H17Cl2NO7/c31-24-13-10-19(15-25(24)32)30(38)40-21-11-8-17(9-12-21)26(34)16-39-29(37)18-4-3-5-20(14-18)33-27(35)22-6-1-2-7-23(22)28(33)36/h1-15H,16H2 |
| InChIKey | KJBKDEOUPNOYAZ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.37 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|