C23H13Cl2NO5 — CID 1332724
[2-(3,4-dichlorophenyl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 1332724) has the molecular formula C23H13Cl2NO5 and a molecular weight of 454.27 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 1332724 |
| Molecular Formula | C23H13Cl2NO5 |
| Molecular Weight | 454.27 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1N1C(=O)c2ccccc2C1=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H13Cl2NO5/c24-17-10-9-13(11-18(17)25)20(27)12-31-23(30)16-7-3-4-8-19(16)26-21(28)14-5-1-2-6-15(14)22(26)29/h1-11H,12H2 |
| InChIKey | FKCOVRUPDCFZGX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.27 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|