C23H14ClNO5S — CID 23968270
[2-(4-chlorophenyl)-2-oxoethyl] 1,3-dioxo-2-(2-sulfanylphenyl)isoindole-5-carboxylate (PubChem CID 23968270) has the molecular formula C23H14ClNO5S and a molecular weight of 451.89 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 1,3-dioxo-2-(2-sulfanylphenyl)isoindole-5-carboxylate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 1,3-dioxo-2-(2-sulfanylphenyl)isoindole-5-carboxylate |
|---|---|
| PubChem CID | 23968270 |
| Molecular Formula | C23H14ClNO5S |
| Molecular Weight | 451.89 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 1,3-dioxo-2-(2-sulfanylphenyl)isoindole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)C(=O)N(c1ccccc1S)C2=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H14ClNO5S/c24-15-8-5-13(6-9-15)19(26)12-30-23(29)14-7-10-16-17(11-14)22(28)25(21(16)27)18-3-1-2-4-20(18)31/h1-11,31H,12H2 |
| InChIKey | OUUNVNVXQFYMIO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 80.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.89 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|