C24H16N2O8 — CID 23791276
[2-(4-nitrophenyl)-2-oxoethyl] 2-(2-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 23791276) has the molecular formula C24H16N2O8 and a molecular weight of 460.40 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] 2-(2-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] 2-(2-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 23791276 |
| Molecular Formula | C24H16N2O8 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] 2-(2-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccccc1N1C(=O)c2ccc(C(=O)OCC(=O)c3ccc([N+](=O)[O-])cc3)cc2C1=O |
| InChI | InChI=1S/C24H16N2O8/c1-33-21-5-3-2-4-19(21)25-22(28)17-11-8-15(12-18(17)23(25)29)24(30)34-13-20(27)14-6-9-16(10-7-14)26(31)32/h2-12H,13H2,1H3 |
| InChIKey | VDULWURYQJBDCQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|