C23H12Cl2N2O7 — CID 1216472
[2-(3-nitrophenyl)-2-oxoethyl] 2-(2,3-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 1216472) has the molecular formula C23H12Cl2N2O7 and a molecular weight of 499.26 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 2-(2,3-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 2-(2,3-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 1216472 |
| Molecular Formula | C23H12Cl2N2O7 |
| Molecular Weight | 499.26 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 2-(2,3-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)C(=O)N(c1cccc(Cl)c1Cl)C2=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H12Cl2N2O7/c24-17-5-2-6-18(20(17)25)26-21(29)15-8-7-13(10-16(15)22(26)30)23(31)34-11-19(28)12-3-1-4-14(9-12)27(32)33/h1-10H,11H2 |
| InChIKey | KVAQTGURRIKCRM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.26 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|