C30H23N3O14S — CID 126186846
[2-(3-nitrophenyl)-2-oxoethyl] 2-[(2R)-4-methylsulfonyl-1-[2-(3-nitrophenyl)-2-oxoethoxy]-1-oxobutan-2-yl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 126186846) has the molecular formula C30H23N3O14S and a molecular weight of 681.59 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 2-[(2R)-4-methylsulfonyl-1-[2-(3-nitrophenyl)-2-oxoethoxy]-1-oxobutan-2-yl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 2-[(2R)-4-methylsulfonyl-1-[2-(3-nitrophenyl)-2-oxoethoxy]-1-oxobutan-2-yl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 126186846 |
| Molecular Formula | C30H23N3O14S |
| Molecular Weight | 681.59 g/mol |
| Exact Mass | 681.09 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 2-[(2R)-4-methylsulfonyl-1-[2-(3-nitrophenyl)-2-oxoethoxy]-1-oxobutan-2-yl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CS(=O)(=O)CC[C@H](C(=O)OCC(=O)c1cccc([N+](=O)[O-])c1)N1C(=O)c2ccc(C(=O)OCC(=O)c3cccc([N+](=O)[O-])c3)cc2C1=O |
| InChI | InChI=1S/C30H23N3O14S/c1-48(44,45)11-10-24(30(39)47-16-26(35)18-5-3-7-21(13-18)33(42)43)31-27(36)22-9-8-19(14-23(22)28(31)37)29(38)46-15-25(34)17-4-2-6-20(12-17)32(40)41/h2-9,12-14,24H,10-11,15-16H2,1H3/t24-/m1/s1 |
| InChIKey | XEUJRWSDKHDYCC-XMMPIXPASA-N |
| XLogP | 2.37 |
| TPSA | 244.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|