C28H21Cl2NO9S — CID 126182925
[4-[2-[(2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoyl]oxyacetyl]phenyl] benzoate (PubChem CID 126182925) has the molecular formula C28H21Cl2NO9S and a molecular weight of 618.45 g/mol. Its IUPAC name is [4-[2-[(2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoyl]oxyacetyl]phenyl] benzoate.
| Compound Name | [4-[2-[(2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoyl]oxyacetyl]phenyl] benzoate |
|---|---|
| PubChem CID | 126182925 |
| Molecular Formula | C28H21Cl2NO9S |
| Molecular Weight | 618.45 g/mol |
| Exact Mass | 617.03 |
| IUPAC Name | [4-[2-[(2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoyl]oxyacetyl]phenyl] benzoate |
| SMILES | CS(=O)(=O)CC[C@@H](C(=O)OCC(=O)c1ccc(OC(=O)c2ccccc2)cc1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C28H21Cl2NO9S/c1-41(37,38)12-11-23(31-25(33)19-13-21(29)22(30)14-20(19)26(31)34)28(36)39-15-24(32)16-7-9-18(10-8-16)40-27(35)17-5-3-2-4-6-17/h2-10,13-14,23H,11-12,15H2,1H3/t23-/m0/s1 |
| InChIKey | UFXANMVTSOTREE-QHCPKHFHSA-N |
| XLogP | 4.04 |
| TPSA | 141.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|