C22H18Cl3NO5 — CID 2299013
[2-(4-chlorophenyl)-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylpentanoate (PubChem CID 2299013) has the molecular formula C22H18Cl3NO5 and a molecular weight of 482.75 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylpentanoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 2299013 |
| Molecular Formula | C22H18Cl3NO5 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] (2S)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](C(=O)OCC(=O)c1ccc(Cl)cc1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C22H18Cl3NO5/c1-11(2)7-18(22(30)31-10-19(27)12-3-5-13(23)6-4-12)26-20(28)14-8-16(24)17(25)9-15(14)21(26)29/h3-6,8-9,11,18H,7,10H2,1-2H3/t18-/m0/s1 |
| InChIKey | CHZMPLYGUCWRST-SFHVURJKSA-N |
| XLogP | 5.08 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|