C22H20Cl2N2O5 — CID 4127738
[2-(2,3-dichloroanilino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate (PubChem CID 4127738) has the molecular formula C22H20Cl2N2O5 and a molecular weight of 463.32 g/mol. Its IUPAC name is [2-(2,3-dichloroanilino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate.
| Compound Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 4127738 |
| Molecular Formula | C22H20Cl2N2O5 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)OCC(=O)Nc1cccc(Cl)c1Cl)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H20Cl2N2O5/c1-12(2)10-17(26-20(28)13-6-3-4-7-14(13)21(26)29)22(30)31-11-18(27)25-16-9-5-8-15(23)19(16)24/h3-9,12,17H,10-11H2,1-2H3,(H,25,27) |
| InChIKey | FZOFGHWGDWBWHM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|