C24H22Cl4N2O5 — CID 4617793
[2-(2-ethylanilino)-2-oxoethyl] 4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanoate (PubChem CID 4617793) has the molecular formula C24H22Cl4N2O5 and a molecular weight of 560.26 g/mol. Its IUPAC name is [2-(2-ethylanilino)-2-oxoethyl] 4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanoate.
| Compound Name | [2-(2-ethylanilino)-2-oxoethyl] 4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanoate |
|---|---|
| PubChem CID | 4617793 |
| Molecular Formula | C24H22Cl4N2O5 |
| Molecular Weight | 560.26 g/mol |
| Exact Mass | 558.03 |
| IUPAC Name | [2-(2-ethylanilino)-2-oxoethyl] 4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanoate |
| SMILES | CCc1ccccc1NC(=O)COC(=O)C(CC(C)C)N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C24H22Cl4N2O5/c1-4-12-7-5-6-8-13(12)29-15(31)10-35-24(34)14(9-11(2)3)30-22(32)16-17(23(30)33)19(26)21(28)20(27)18(16)25/h5-8,11,14H,4,9-10H2,1-3H3,(H,29,31) |
| InChIKey | LIIVRWRBBCCBNV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.26 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|