C30H26Cl4N2O7S — CID 99656323
ethyl 4-(4-methylphenyl)-2-[[2-[(2R)-4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanoyl]oxyacetyl]amino]thiophene-3-carboxylate (PubChem CID 99656323) has the molecular formula C30H26Cl4N2O7S and a molecular weight of 700.42 g/mol. Its IUPAC name is ethyl 4-(4-methylphenyl)-2-[[2-[(2R)-4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanoyl]oxyacetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-methylphenyl)-2-[[2-[(2R)-4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanoyl]oxyacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 99656323 |
| Molecular Formula | C30H26Cl4N2O7S |
| Molecular Weight | 700.42 g/mol |
| Exact Mass | 698.02 |
| IUPAC Name | ethyl 4-(4-methylphenyl)-2-[[2-[(2R)-4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanoyl]oxyacetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)COC(=O)[C@@H](CC(C)C)N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C30H26Cl4N2O7S/c1-5-42-30(41)19-16(15-8-6-14(4)7-9-15)12-44-26(19)35-18(37)11-43-29(40)17(10-13(2)3)36-27(38)20-21(28(36)39)23(32)25(34)24(33)22(20)31/h6-9,12-13,17H,5,10-11H2,1-4H3,(H,35,37)/t17-/m1/s1 |
| InChIKey | SEJRLLOBMGEUFT-QGZVFWFLSA-N |
| XLogP | 7.71 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.42 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|