C22H17Cl5N2O5 — CID 4617936
[2-(3-chloroanilino)-2-oxoethyl] 4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanoate (PubChem CID 4617936) has the molecular formula C22H17Cl5N2O5 and a molecular weight of 566.65 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanoate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanoate |
|---|---|
| PubChem CID | 4617936 |
| Molecular Formula | C22H17Cl5N2O5 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 563.96 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanoate |
| SMILES | CC(C)CC(C(=O)OCC(=O)Nc1cccc(Cl)c1)N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C22H17Cl5N2O5/c1-9(2)6-12(22(33)34-8-13(30)28-11-5-3-4-10(23)7-11)29-20(31)14-15(21(29)32)17(25)19(27)18(26)16(14)24/h3-5,7,9,12H,6,8H2,1-2H3,(H,28,30) |
| InChIKey | RTIFDDLPZIYQKY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|