C28H22I4N2O6 — CID 4656674
[2-oxo-2-(4-phenoxyanilino)ethyl] 4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoate (PubChem CID 4656674) has the molecular formula C28H22I4N2O6 and a molecular weight of 990.11 g/mol. Its IUPAC name is [2-oxo-2-(4-phenoxyanilino)ethyl] 4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoate.
| Compound Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoate |
|---|---|
| PubChem CID | 4656674 |
| Molecular Formula | C28H22I4N2O6 |
| Molecular Weight | 990.11 g/mol |
| Exact Mass | 989.77 |
| IUPAC Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoate |
| SMILES | CC(C)CC(C(=O)OCC(=O)Nc1ccc(Oc2ccccc2)cc1)N1C(=O)c2c(I)c(I)c(I)c(I)c2C1=O |
| InChI | InChI=1S/C28H22I4N2O6/c1-14(2)12-18(34-26(36)20-21(27(34)37)23(30)25(32)24(31)22(20)29)28(38)39-13-19(35)33-15-8-10-17(11-9-15)40-16-6-4-3-5-7-16/h3-11,14,18H,12-13H2,1-2H3,(H,33,35) |
| InChIKey | GUZJXJABOKNTMJ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.11 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|