C23H16ClF3I4N2O5 — CID 22693902
[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoate (PubChem CID 22693902) has the molecular formula C23H16ClF3I4N2O5 and a molecular weight of 1000.45 g/mol. Its IUPAC name is [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoate.
| Compound Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoate |
|---|---|
| PubChem CID | 22693902 |
| Molecular Formula | C23H16ClF3I4N2O5 |
| Molecular Weight | 1000.45 g/mol |
| Exact Mass | 999.69 |
| IUPAC Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoate |
| SMILES | CC(C)CC(C(=O)OCC(=O)Nc1cc(C(F)(F)F)ccc1Cl)N1C(=O)c2c(I)c(I)c(I)c(I)c2C1=O |
| InChI | InChI=1S/C23H16ClF3I4N2O5/c1-8(2)5-12(33-20(35)14-15(21(33)36)17(29)19(31)18(30)16(14)28)22(37)38-7-13(34)32-11-6-9(23(25,26)27)3-4-10(11)24/h3-4,6,8,12H,5,7H2,1-2H3,(H,32,34) |
| InChIKey | QSRPGEUDDGRVEY-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1000.45 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|