C22H14ClF3I4N2O5 — CID 99657426
[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] (2R)-3-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 99657426) has the molecular formula C22H14ClF3I4N2O5 and a molecular weight of 986.43 g/mol. Its IUPAC name is [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] (2R)-3-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] (2R)-3-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 99657426 |
| Molecular Formula | C22H14ClF3I4N2O5 |
| Molecular Weight | 986.43 g/mol |
| Exact Mass | 985.67 |
| IUPAC Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] (2R)-3-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | CC(C)[C@H](C(=O)OCC(=O)Nc1cc(C(F)(F)F)ccc1Cl)N1C(=O)c2c(I)c(I)c(I)c(I)c2C1=O |
| InChI | InChI=1S/C22H14ClF3I4N2O5/c1-7(2)18(32-19(34)12-13(20(32)35)15(28)17(30)16(29)14(12)27)21(36)37-6-11(33)31-10-5-8(22(24,25)26)3-4-9(10)23/h3-5,7,18H,6H2,1-2H3,(H,31,33)/t18-/m1/s1 |
| InChIKey | AZONEASZBZIABV-GOSISDBHSA-N |
| XLogP | 6.58 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.43 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|