C13H15ClF3NOS — CID 112779384
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(2-methylpropylsulfanyl)acetamide (PubChem CID 112779384) has the molecular formula C13H15ClF3NOS and a molecular weight of 325.78 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(2-methylpropylsulfanyl)acetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(2-methylpropylsulfanyl)acetamide |
|---|---|
| PubChem CID | 112779384 |
| Molecular Formula | C13H15ClF3NOS |
| Molecular Weight | 325.78 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(2-methylpropylsulfanyl)acetamide |
| SMILES | CC(C)CSCC(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C13H15ClF3NOS/c1-8(2)6-20-7-12(19)18-11-5-9(13(15,16)17)3-4-10(11)14/h3-5,8H,6-7H2,1-2H3,(H,18,19) |
| InChIKey | UHKXXMJQRVPLLJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.78 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |