C19H13ClF3NOS — CID 7402973
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-naphthalen-2-ylsulfanylacetamide (PubChem CID 7402973) has the molecular formula C19H13ClF3NOS and a molecular weight of 395.83 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-naphthalen-2-ylsulfanylacetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-naphthalen-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 7402973 |
| Molecular Formula | C19H13ClF3NOS |
| Molecular Weight | 395.83 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-naphthalen-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1ccc2ccccc2c1)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C19H13ClF3NOS/c20-16-8-6-14(19(21,22)23)10-17(16)24-18(25)11-26-15-7-5-12-3-1-2-4-13(12)9-15/h1-10H,11H2,(H,24,25) |
| InChIKey | PSBYDFSTWJZDOF-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.83 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |