C20H13ClF3NO3 — CID 7698344
[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] naphthalene-2-carboxylate (PubChem CID 7698344) has the molecular formula C20H13ClF3NO3 and a molecular weight of 407.78 g/mol. Its IUPAC name is [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] naphthalene-2-carboxylate.
| Compound Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7698344 |
| Molecular Formula | C20H13ClF3NO3 |
| Molecular Weight | 407.78 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] naphthalene-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2ccccc2c1)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C20H13ClF3NO3/c21-16-8-7-15(20(22,23)24)10-17(16)25-18(26)11-28-19(27)14-6-5-12-3-1-2-4-13(12)9-14/h1-10H,11H2,(H,25,26) |
| InChIKey | PLEZGPFJJCFHAK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.78 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |