C20H18ClF3N2O4 — CID 17258688
(2-anilino-2-oxoethyl) 5-[2-chloro-5-(trifluoromethyl)anilino]-5-oxopentanoate (PubChem CID 17258688) has the molecular formula C20H18ClF3N2O4 and a molecular weight of 442.82 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 5-[2-chloro-5-(trifluoromethyl)anilino]-5-oxopentanoate.
| Compound Name | (2-anilino-2-oxoethyl) 5-[2-chloro-5-(trifluoromethyl)anilino]-5-oxopentanoate |
|---|---|
| PubChem CID | 17258688 |
| Molecular Formula | C20H18ClF3N2O4 |
| Molecular Weight | 442.82 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | (2-anilino-2-oxoethyl) 5-[2-chloro-5-(trifluoromethyl)anilino]-5-oxopentanoate |
| SMILES | O=C(COC(=O)CCCC(=O)Nc1cc(C(F)(F)F)ccc1Cl)Nc1ccccc1 |
| InChI | InChI=1S/C20H18ClF3N2O4/c21-15-10-9-13(20(22,23)24)11-16(15)26-17(27)7-4-8-19(29)30-12-18(28)25-14-5-2-1-3-6-14/h1-3,5-6,9-11H,4,7-8,12H2,(H,25,28)(H,26,27) |
| InChIKey | KUSWOPHPTBPVTA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.82 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |