C21H18ClF3N2O6 — CID 2902130
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 5-[2-chloro-5-(trifluoromethyl)anilino]-5-oxopentanoate (PubChem CID 2902130) has the molecular formula C21H18ClF3N2O6 and a molecular weight of 486.83 g/mol. Its IUPAC name is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 5-[2-chloro-5-(trifluoromethyl)anilino]-5-oxopentanoate.
| Compound Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 5-[2-chloro-5-(trifluoromethyl)anilino]-5-oxopentanoate |
|---|---|
| PubChem CID | 2902130 |
| Molecular Formula | C21H18ClF3N2O6 |
| Molecular Weight | 486.83 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 5-[2-chloro-5-(trifluoromethyl)anilino]-5-oxopentanoate |
| SMILES | Cc1ccc(C(=O)COC(=O)CCCC(=O)Nc2cc(C(F)(F)F)ccc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H18ClF3N2O6/c1-12-5-6-13(9-17(12)27(31)32)18(28)11-33-20(30)4-2-3-19(29)26-16-10-14(21(23,24)25)7-8-15(16)22/h5-10H,2-4,11H2,1H3,(H,26,29) |
| InChIKey | WXLCDYABQWBARP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.83 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|