C29H25N3O11 — CID 19645359
[2-(3-nitrophenyl)-2-oxoethyl] 4-[[5-[2-(4-methyl-3-nitrophenyl)-2-oxoethoxy]-5-oxopentanoyl]amino]benzoate (PubChem CID 19645359) has the molecular formula C29H25N3O11 and a molecular weight of 591.53 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 4-[[5-[2-(4-methyl-3-nitrophenyl)-2-oxoethoxy]-5-oxopentanoyl]amino]benzoate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 4-[[5-[2-(4-methyl-3-nitrophenyl)-2-oxoethoxy]-5-oxopentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 19645359 |
| Molecular Formula | C29H25N3O11 |
| Molecular Weight | 591.53 g/mol |
| Exact Mass | 591.15 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 4-[[5-[2-(4-methyl-3-nitrophenyl)-2-oxoethoxy]-5-oxopentanoyl]amino]benzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)CCCC(=O)Nc2ccc(C(=O)OCC(=O)c3cccc([N+](=O)[O-])c3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H25N3O11/c1-18-8-9-21(15-24(18)32(40)41)25(33)16-42-28(36)7-3-6-27(35)30-22-12-10-19(11-13-22)29(37)43-17-26(34)20-4-2-5-23(14-20)31(38)39/h2,4-5,8-15H,3,6-7,16-17H2,1H3,(H,30,35) |
| InChIKey | RDABYFKXSQFWLC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 202.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|