C28H22ClN3O11 — CID 19645357
[2-(3-nitrophenyl)-2-oxoethyl] 4-[[5-[2-(4-chloro-3-nitrophenyl)-2-oxoethoxy]-5-oxopentanoyl]amino]benzoate (PubChem CID 19645357) has the molecular formula C28H22ClN3O11 and a molecular weight of 611.95 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 4-[[5-[2-(4-chloro-3-nitrophenyl)-2-oxoethoxy]-5-oxopentanoyl]amino]benzoate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 4-[[5-[2-(4-chloro-3-nitrophenyl)-2-oxoethoxy]-5-oxopentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 19645357 |
| Molecular Formula | C28H22ClN3O11 |
| Molecular Weight | 611.95 g/mol |
| Exact Mass | 611.09 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 4-[[5-[2-(4-chloro-3-nitrophenyl)-2-oxoethoxy]-5-oxopentanoyl]amino]benzoate |
| SMILES | O=C(CCCC(=O)OCC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)Nc1ccc(C(=O)OCC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C28H22ClN3O11/c29-22-12-9-19(14-23(22)32(40)41)24(33)15-42-27(36)6-2-5-26(35)30-20-10-7-17(8-11-20)28(37)43-16-25(34)18-3-1-4-21(13-18)31(38)39/h1,3-4,7-14H,2,5-6,15-16H2,(H,30,35) |
| InChIKey | WAFHDTGDDIDEQN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 202.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.95 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|